Difference between revisions of "ARACHIDONIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16990 == * transcription-direction: ** negative * right-end-position: ** 143796 * left-end-position: ** 140111 * centisome-position: ** 51.219147...") |
(Created page with "Category:metabolite == Metabolite ARACHIDONIC_ACID == * common-name: ** arachidonate * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** yzxbapsdxzzrgb-dofzraljs...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ARACHIDONIC_ACID == |
| − | * | + | * common-name: |
| − | ** | + | ** arachidonate |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** yzxbapsdxzzrgb-dofzraljsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 303.464 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ARACHIDONATE-15-LIPOXYGENASE-RXN]] |
| − | + | * [[ARACHIDONATE-5-LIPOXYGENASE-RXN]] | |
| − | * [[ | + | * [[RXN-13395]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-16016]] |
| − | {{#set: | + | * [[RXN6666-2]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=arachidonate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}} |
| − | + | {{#set: molecular-weight=303.464}} | |
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ARACHIDONIC_ACID
- common-name:
- arachidonate
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- yzxbapsdxzzrgb-dofzraljsa-m
- molecular-weight:
- 303.464
