Difference between revisions of "ARACHIDONIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-CONIFERALDEHYDE == * common-name: ** 5-hydroxy-coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc(o)=c(o)1) * inchi-key: ** iehpl...")
(Created page with "Category:metabolite == Metabolite carboxybiotin-L-lysine-in-BCCP-dimers == * common-name: ** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-CONIFERALDEHYDE ==
+
== Metabolite carboxybiotin-L-lysine-in-BCCP-dimers ==
 
* common-name:
 
* common-name:
** 5-hydroxy-coniferaldehyde
+
** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine
* smiles:
 
** coc1(=cc(c=cc=o)=cc(o)=c(o)1)
 
* inchi-key:
 
** iehplrvwohzkcs-nscuhmnnsa-n
 
* molecular-weight:
 
** 194.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1143]]
+
* [[RXN0-5055]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-coniferaldehyde}}
+
{{#set: common-name=a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine}}
{{#set: inchi-key=inchikey=iehplrvwohzkcs-nscuhmnnsa-n}}
 
{{#set: molecular-weight=194.187}}
 

Revision as of 13:09, 14 January 2021

Metabolite carboxybiotin-L-lysine-in-BCCP-dimers

  • common-name:
    • a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.