Difference between revisions of "ARG"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-10277 ==
+== Metabolite ARG ==
 * common-name:
-** lotaustralin
+** l-arginine
 * smiles:
-** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
+** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
 * inchi-key:
-** wewbwvmtoyuphh-qhaqebjbsa-n
+** odksfydxxfifqn-bypyzucnsa-o
 * molecular-weight:
-** 261.274
+** 175.21
 == Reaction(s) known to consume the compound ==
-* [[RXN-9674]]
+* [[1.5.1.11-RXN]]
+* [[1.5.1.19-RXN]]
+* [[ARG-OXIDATION-RXN]]
+* [[ARGDECARBOX-RXN]]
+* [[ARGINASE-RXN]]
+* [[ARGININE--TRNA-LIGASE-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[NITRIC-OXIDE-SYNTHASE-RXN]]
+* [[RXN-13564]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13603]]
+* [[ARGDECARBOX-RXN]]
+* [[ARGINASE-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=lotaustralin}}
+{{#set: common-name=l-arginine}}
-{{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}}
+{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
-{{#set: molecular-weight=261.274}}
+{{#set: molecular-weight=175.21}}