Difference between revisions of "ARG"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN 35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN] == * direction: ** left-to...")
 
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN 35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN] ==
+
== Metabolite ARG ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3',5'-cyclic-gmp phosphodiesterase
+
** l-arginine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.4.35 ec-3.1.4.35]
+
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CGMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GMP]][c] '''+''' 1 [[PROTON]][c]
+
** odksfydxxfifqn-bypyzucnsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18680]]
+
** 175.21
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[1.5.1.11-RXN]]
−
* Gene: [[SJ14526]]
+
* [[1.5.1.19-RXN]]
−
** Category: [[annotation]]
+
* [[ARG-OXIDATION-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ARGDECARBOX-RXN]]
−
* Gene: [[SJ09726]]
+
* [[ARGINASE-RXN]]
−
** Category: [[annotation]]
+
* [[ARGININE--TRNA-LIGASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ARGSUCCINLYA-RXN]]
−
== Pathway(s) ==
+
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-13564]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[biomass_rxn]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
* RHEA:
+
* [[ARGDECARBOX-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16958 16958]
+
* [[ARGINASE-RXN]]
−
* LIGAND-RXN:
+
* [[ARGSUCCINLYA-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01234 R01234]
+
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
−
* UNIPROT:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.uniprot.org/uniprot/P04972 P04972]
+
{{#set: common-name=l-arginine}}
−
** [http://www.uniprot.org/uniprot/P16586 P16586]
+
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
−
** [http://www.uniprot.org/uniprot/P23439 P23439]
+
{{#set: molecular-weight=175.21}}
−
** [http://www.uniprot.org/uniprot/P35913 P35913]
 
−
** [http://www.uniprot.org/uniprot/P33726 P33726]
 
−
** [http://www.uniprot.org/uniprot/P09174 P09174]
 
−
** [http://www.uniprot.org/uniprot/P52731 P52731]
 
−
** [http://www.uniprot.org/uniprot/P51160 P51160]
 
−
** [http://www.uniprot.org/uniprot/P18545 P18545]
 
−
** [http://www.uniprot.org/uniprot/O76074 O76074]
 
−
** [http://www.uniprot.org/uniprot/P11541 P11541]
 
−
** [http://www.uniprot.org/uniprot/P27664 P27664]
 
−
** [http://www.uniprot.org/uniprot/Q62037 Q62037]
 
−
** [http://www.uniprot.org/uniprot/P23440 P23440]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3',5'-cyclic-gmp phosphodiesterase}}
 
−
{{#set: ec-number=ec-3.1.4.35}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite ARG

  • common-name:
    • l-arginine
  • smiles:
    • c(nc(n)=[n+])ccc([n+])c(=o)[o-]
  • inchi-key:
    • odksfydxxfifqn-bypyzucnsa-o
  • molecular-weight:
    • 175.21

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ARG&oldid=139063"