Difference between revisions of "ARG-GLU-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] == * common-name: ** menaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-R-S-oxides Protein-L-methionine-R-S-oxides] == * common-name: ** a protein...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-R-S-oxides Protein-L-methionine-R-S-oxides] ==
 
* common-name:
 
* common-name:
** menaquinol-12
+
** a protein-l-methionine-(r)-s-oxide
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
* inchi-key:
 
** fwfjgqgpmzxtlm-wppieqshsa-n
 
* molecular-weight:
 
** 991.617
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.8.4.12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9363]]
+
* [[1.8.4.12-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-12}}
+
{{#set: common-name=a protein-l-methionine-(r)-s-oxide}}
{{#set: inchi-key=inchikey=fwfjgqgpmzxtlm-wppieqshsa-n}}
 
{{#set: molecular-weight=991.617}}
 

Revision as of 09:22, 27 August 2019

Metabolite Protein-L-methionine-R-S-oxides

  • common-name:
    • a protein-l-methionine-(r)-s-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality