Difference between revisions of "ARG-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uracil-1939 == * common-name: ** a uracil1939 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11601 == Rea...") |
(Created page with "Category:metabolite == Metabolite GLUCOSAMINE-1P == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) * inchi-key: ** y...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLUCOSAMINE-1P == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucosamine 1-phosphate |
| + | * smiles: | ||
| + | ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** ymjbyrvfgyxulk-qzabapfnsa-m | ||
| + | * molecular-weight: | ||
| + | ** 258.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.3.1.157-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucosamine 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}} | ||
| + | {{#set: molecular-weight=258.144}} | ||
Revision as of 11:12, 15 January 2021
Contents
Metabolite GLUCOSAMINE-1P
- common-name:
- d-glucosamine 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
- inchi-key:
- ymjbyrvfgyxulk-qzabapfnsa-m
- molecular-weight:
- 258.144
