Difference between revisions of "ARG-tRNAs"

Latest revision as of 11:11, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17046 ==
+== Metabolite ARG-tRNAs ==
 * common-name:
-** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+** a trnaarg
-* smiles:
-** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
-* inchi-key:
-** yjisldwviydioe-wgtgpsahsa-l
-* molecular-weight:
-** 842.848
 == Reaction(s) known to consume the compound ==
-* [[RXN-15681]]
+* [[ARGININE--TRNA-LIGASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-15680]]
+* [[ARGINYLTRANSFERASE-RXN]]
+* [[RXN-17888]]
+* [[RXN-17889]]
+* [[RXN-17890]]
+* [[RXN-17891]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+{{#set: common-name=a trnaarg}}
-{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
-{{#set: molecular-weight=842.848}}