Difference between revisions of "ARG-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...")
(Created page with "Category:metabolite == Metabolite CPD-8625 == * common-name: ** a [protein]-l-proline (ω = 0) == Reaction(s) known to consume the compound == * PEPTIDYLPROLYL-ISOM...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17046 ==
+
== Metabolite CPD-8625 ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** a [protein]-l-proline (ω = 0)
* smiles:
 
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** yjisldwviydioe-wgtgpsahsa-l
 
* molecular-weight:
 
** 842.848
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15681]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15680]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a [protein]-l-proline (ω = 0)}}
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
 
{{#set: molecular-weight=842.848}}
 

Revision as of 13:07, 14 January 2021

Metabolite CPD-8625

  • common-name:
    • a [protein]-l-proline (ω = 0)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-proline (ω = 0)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.