Difference between revisions of "ARGININE-SYN4-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(...")
(Created page with "Category:pathway == Pathway PWY-6700 == * taxonomic-range: ** tax-2 * common-name: ** queuosine biosynthesis == Reaction(s) found == * RXN0-1321 == Reaction(s) not fou...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12706 CPD-12706] ==
+
== Pathway PWY-6700 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-fluoro-5-deoxy-d-ribose 1-phosphate
+
** queuosine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
+
* [[RXN0-1321]]
* inchi-key:
+
== Reaction(s) not found ==
** luqfmenctwebsq-txicztdvsa-l
+
* [NoneRXN0-1342 RXN0-1342]
* molecular-weight:
+
* [NoneRXN-12104 RXN-12104]
** 230.086
+
* [NoneRXN0-4022 RXN0-4022]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=queuosine biosynthesis}}
* [[RXN-11743]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=5-fluoro-5-deoxy-d-ribose 1-phosphate}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=luqfmenctwebsq-txicztdvsa-l}}
 
{{#set: molecular-weight=230.086}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-6700

  • taxonomic-range:
    • tax-2
  • common-name:
    • queuosine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN0-1342 RXN0-1342]
  • [NoneRXN-12104 RXN-12104]
  • [NoneRXN0-4022 RXN0-4022]