Difference between revisions of "ARGSYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == |
* common-name: | * common-name: | ||
| − | ** | + | ** hydroxybupropion |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** akoaevosdhivfx-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.752 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-181]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hydroxybupropion}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.752}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-3483
- common-name:
- hydroxybupropion
- smiles:
- cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
- inchi-key:
- akoaevosdhivfx-uhfffaoysa-o
- molecular-weight:
- 256.752
