Difference between revisions of "ARSENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite ARSENATE == * common-name: ** arsenate * smiles: ** [as](=o)(o)([o-])[o-] * inchi-key: ** djhgafsjwgloiv-uhfffaoysa-l * molecular-weight:...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ARSENATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** arsenate |
* smiles: | * smiles: | ||
| − | ** | + | ** [as](=o)(o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** djhgafsjwgloiv-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 139.927 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7001]] |
| + | * [[RXN-982]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=arsenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=djhgafsjwgloiv-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=139.927}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ARSENATE
- common-name:
- arsenate
- smiles:
- [as](=o)(o)([o-])[o-]
- inchi-key:
- djhgafsjwgloiv-uhfffaoysa-l
- molecular-weight:
- 139.927
