Difference between revisions of "ARSENATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14037 RXN-14037] == * direction: ** reversible == Reaction formula == * 1 2-ACETO-LACTATE[c...") |
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite FMNH2 == |
| − | * | + | * common-name: |
| − | ** | + | ** fmnh2 |
| − | == | + | * smiles: |
| − | + | ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) | |
| − | == | + | * inchi-key: |
| − | == | + | ** ytnixzgthtvjbw-scrdcrapsa-l |
| − | + | * molecular-weight: | |
| − | * | + | ** 456.348 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-9510]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-9510]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=fmnh2}} | |
| − | + | {{#set: inchi-key=inchikey=ytnixzgthtvjbw-scrdcrapsa-l}} | |
| − | {{#set: | + | {{#set: molecular-weight=456.348}} |
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
Revision as of 20:34, 18 December 2020
Contents
Metabolite FMNH2
- common-name:
- fmnh2
- smiles:
- cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3)))
- inchi-key:
- ytnixzgthtvjbw-scrdcrapsa-l
- molecular-weight:
- 456.348
