Difference between revisions of "ASCORBATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13665 == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite ASCORBATE == * common-name: ** l-ascorbate * smiles: ** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1) * inchi-key: ** ciwbshskhkdkbq-jlaznsocsa-m *...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ASCORBATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-ascorbate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ciwbshskhkdkbq-jlaznsocsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| + | * [[ETHYL-RXN]] | ||
| + | * [[RXN-12440]] | ||
| + | * [[RXN-13185]] | ||
| + | * [[RXN-15598]] | ||
| + | * [[RXN-19200]] | ||
| + | * [[RXN-3521]] | ||
| + | * [[RXN-7984]] | ||
| + | * [[RXN-7985]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1.3.3.12-RXN]] |
| + | * [[1.6.5.4-RXN]] | ||
| + | * [[1.8.5.1-RXN]] | ||
| + | * [[RXN-11153]] | ||
| + | * [[RXN-12440]] | ||
| + | * [[RXN-13185]] | ||
| + | * [[RXN-13689]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-ascorbate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ciwbshskhkdkbq-jlaznsocsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.118}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ASCORBATE
- common-name:
- l-ascorbate
- smiles:
- c(o)c(o)[ch]1(c([o-])=c(o)c(=o)o1)
- inchi-key:
- ciwbshskhkdkbq-jlaznsocsa-m
- molecular-weight:
- 175.118
Reaction(s) known to consume the compound
- DOPAMINE-BETA-MONOOXYGENASE-RXN
- ETHYL-RXN
- RXN-12440
- RXN-13185
- RXN-15598
- RXN-19200
- RXN-3521
- RXN-7984
- RXN-7985
