Difference between revisions of "ASCORBATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite CPD-20012 == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) * inchi-key: ** yqhmwtpy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-20012 == |
* common-name: | * common-name: | ||
| − | ** | + | ** naringenin chalcone |
| + | * smiles: | ||
| + | ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) | ||
| + | * inchi-key: | ||
| + | ** yqhmwtpyorbcmf-zzxkwvifsa-n | ||
| + | * molecular-weight: | ||
| + | ** 272.257 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[APIGNAR-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=naringenin chalcone}} |
| + | {{#set: inchi-key=inchikey=yqhmwtpyorbcmf-zzxkwvifsa-n}} | ||
| + | {{#set: molecular-weight=272.257}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-20012
- common-name:
- naringenin chalcone
- smiles:
- c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o)
- inchi-key:
- yqhmwtpyorbcmf-zzxkwvifsa-n
- molecular-weight:
- 272.257
