Difference between revisions of "ASN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIAL AIAL] == * direction: ** reversible * common-name: ** 1-(5'-phosphoribosyl)-5-amino-4-(n-succi...")
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIAL AIAL] ==
+
== Metabolite ASN ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** 1-(5'-phosphoribosyl)-5-amino-4-(n-succinocarboxamide)-imidazole amp-lyase
+
** l-asparagine
== Reaction formula ==
+
* smiles:
* 1.0 [[P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE]][c] '''<=>''' 1.0 [[AICAR]][c] '''+''' 1.0 [[FUM]][c]
+
** c(cc(c(=o)[o-])[n+])(n)=o
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ06544]]
+
** dcxyfedjocdnaf-reohclbhsa-n
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 132.119
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[ASPARAGHYD-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
== External links  ==
+
* [[biomass_rxn]]
{{#set: direction=reversible}}
+
== Reaction(s) known to produce the compound ==
{{#set: common-name=1-(5'-phosphoribosyl)-5-amino-4-(n-succinocarboxamide)-imidazole amp-lyase}}
+
* [[ASNSYNA-RXN]]
{{#set: nb gene associated=1}}
+
* [[ASNSYNB-RXN]]
{{#set: nb pathway associated=0}}
+
* [[RXN-12460]]
{{#set: reconstruction category=orthology}}
+
* [[RXN0-6982]]
{{#set: reconstruction tool=pantograph}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction comment=n.a}}
+
{{#set: common-name=l-asparagine}}
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
 +
{{#set: molecular-weight=132.119}}

Latest revision as of 11:17, 18 March 2021

Metabolite ASN

  • common-name:
    • l-asparagine
  • smiles:
    • c(cc(c(=o)[o-])[n+])(n)=o
  • inchi-key:
    • dcxyfedjocdnaf-reohclbhsa-n
  • molecular-weight:
    • 132.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality