Difference between revisions of "ASN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11520 RXN-11520] == * direction: ** left-to-right == Reaction formula == * 1 1-7-DIMETHYLXANT...")
 
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11520 RXN-11520] ==
+
== Metabolite ASN ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** l-asparagine
−
== Reaction formula ==
+
* smiles:
−
* 1 [[1-7-DIMETHYLXANTHINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-12483]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
** c(cc(c(=o)[o-])[n+])(n)=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ05674]]
+
** dcxyfedjocdnaf-reohclbhsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 132.119
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ13098]]
+
* [[ASPARAGHYD-RXN]]
−
** Category: [[orthology]]
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[biomass_rxn]]
−
* Gene: [[SJ05668]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[ASNSYNA-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ASNSYNB-RXN]]
−
* Gene: [[SJ05660]]
+
* [[RXN-12460]]
−
** Category: [[orthology]]
+
* [[RXN0-6982]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=l-asparagine}}
−
* [[PWY-6632]], caffeine degradation IV (bacteria, via demethylation and oxidation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632]
+
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
−
** '''4''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=132.119}}
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07977 R07977]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite ASN

  • common-name:
    • l-asparagine
  • smiles:
    • c(cc(c(=o)[o-])[n+])(n)=o
  • inchi-key:
    • dcxyfedjocdnaf-reohclbhsa-n
  • molecular-weight:
    • 132.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ASN&oldid=139672"