Difference between revisions of "ASN"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11520 RXN-11520] == * direction: ** left-to-right == Reaction formula == * 1 1-7-DIMETHYLXANT...") |
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...") |
||
(9 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ASN == |
− | * | + | * common-name: |
− | ** | + | ** l-asparagine |
− | + | * smiles: | |
− | * | + | ** c(cc(c(=o)[o-])[n+])(n)=o |
− | + | * inchi-key: | |
− | * | + | ** dcxyfedjocdnaf-reohclbhsa-n |
− | ** | + | * molecular-weight: |
− | + | ** 132.119 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | + | * [[ASPARAGHYD-RXN]] | |
− | + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] | |
− | ** | + | * [[biomass_rxn]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[ASNSYNA-RXN]] |
− | * | + | * [[ASNSYNB-RXN]] |
− | + | * [[RXN-12460]] | |
− | * | + | * [[RXN0-6982]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=l-asparagine}} |
− | * [[ | + | {{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}} |
− | * | + | {{#set: molecular-weight=132.119}} |
− | |||
− | |||
− | * | ||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ASN
- common-name:
- l-asparagine
- smiles:
- c(cc(c(=o)[o-])[n+])(n)=o
- inchi-key:
- dcxyfedjocdnaf-reohclbhsa-n
- molecular-weight:
- 132.119