Difference between revisions of "ASN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite Quinones == * common-name: ** a quinone == Reaction(s) known to consume the compound == * QOR-RXN == Reaction(s) known to produce the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAMMA-LINOLENOYL-COA ==
+
== Metabolite Quinones ==
 
* common-name:
 
* common-name:
** γ-linolenoyl-coa
+
** a quinone
* smiles:
 
** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xzqyptbyqyzgru-fhdveodpsa-j
 
* molecular-weight:
 
** 1023.921
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12777]]
+
* [[QOR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.19.3-RXN]]
 
* [[RXN-16043]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-linolenoyl-coa}}
+
{{#set: common-name=a quinone}}
{{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}}
 
{{#set: molecular-weight=1023.921}}
 

Revision as of 15:30, 5 January 2021

Metabolite Quinones

  • common-name:
    • a quinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality