Difference between revisions of "ASN-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1825 == * common-name: ** β-l-arabinose 1-phosphate * smiles: ** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-]) * inchi-key: ** ilxhfxfppzg...") |
(Created page with "Category:metabolite == Metabolite ASN-tRNAs == * common-name: ** trnaasn == Reaction(s) known to consume the compound == * ASPARAGINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ASN-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** trnaasn |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12460]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trnaasn}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ASN-tRNAs
- common-name:
- trnaasn
