Difference between revisions of "ASPARAGINE-DEG1-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LONG-CHAIN-KETONE LONG-CHAIN-KETONE] == * common-name: ** a ketone == Reaction(s) known to cons...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4207 CPD-4207] == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LONG-CHAIN-KETONE LONG-CHAIN-KETONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4207 CPD-4207] ==
 
* common-name:
 
* common-name:
** a ketone
+
** isopentenyl adenosine
 +
* smiles:
 +
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
 +
* inchi-key:
 +
** usvmjsalorzvdv-sdbhatresa-n
 +
* molecular-weight:
 +
** 335.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
+
* [[RXN-4315]]
* [[RXN-12267]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
* [[RXN-12448]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
+
* [[RXN-4315]]
* [[RXN-12267]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
* [[RXN-12448]]
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ketone}}
+
{{#set: common-name=isopentenyl adenosine}}
 +
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
 +
{{#set: molecular-weight=335.362}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-4207

  • common-name:
    • isopentenyl adenosine
  • smiles:
    • cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
  • inchi-key:
    • usvmjsalorzvdv-sdbhatresa-n
  • molecular-weight:
    • 335.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality