Difference between revisions of "ASPASN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[...")
(Created page with "Category:pathway == Pathway ASPASN-PWY == * taxonomic-range: ** tax-2 * common-name: ** superpathway of l-aspartate and l-asparagine biosynthesis == Reaction(s) found == *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Pathway ASPASN-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** superpathway of l-aspartate and l-asparagine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
* [[ASPARAGHYD-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ayfxpgxazmfwnh-onegzznksa-m
+
* [NoneASPARTASE-RXN ASPARTASE-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 139.087
+
{{#set: common-name=superpathway of l-aspartate and l-asparagine biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-9868]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=trans-dienelactone}}
 
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
 
{{#set: molecular-weight=139.087}}
 

Latest revision as of 10:59, 18 March 2021

Pathway ASPASN-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • superpathway of l-aspartate and l-asparagine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneASPARTASE-RXN ASPARTASE-RXN]