Difference between revisions of "ASPASN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[...")
(Created page with "Category:pathway == Pathway PWY-6730 == * taxonomic-range: ** tax-131567 ** tax-33090 * common-name: ** methylhalides biosynthesis (plants) == Reaction(s) found == * RXN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] ==
+
== Pathway PWY-6730 ==
 +
* taxonomic-range:
 +
** tax-131567
 +
** tax-33090
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** methylhalides biosynthesis (plants)
* smiles:
+
== Reaction(s) found ==
** c1(=cc(=o)oc(=cc(=o)[o-])1)
+
* [[RXN-11241]]
* inchi-key:
+
* [[RXN-11267]]
** ayfxpgxazmfwnh-onegzznksa-m
+
* [[RXN-11268]]
* molecular-weight:
+
== Reaction(s) not found ==
** 139.087
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090|tax-131567}}
* [[RXN-9868]]
+
{{#set: common-name=methylhalides biosynthesis (plants)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=trans-dienelactone}}
+
{{#set: nb total reaction=3}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
 
{{#set: molecular-weight=139.087}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6730

  • taxonomic-range:
    • tax-131567
    • tax-33090
  • common-name:
    • methylhalides biosynthesis (plants)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present