Difference between revisions of "ASPASN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] == * common-name: ** an [rna]-3'-hydroxyl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-dienelactone |
| + | * smiles: | ||
| + | ** c1(=cc(=o)oc(=cc(=o)[o-])1) | ||
| + | * inchi-key: | ||
| + | ** ayfxpgxazmfwnh-onegzznksa-m | ||
| + | * molecular-weight: | ||
| + | ** 139.087 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9868]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-dienelactone}} |
| + | {{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}} | ||
| + | {{#set: molecular-weight=139.087}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-10608
- common-name:
- trans-dienelactone
- smiles:
- c1(=cc(=o)oc(=cc(=o)[o-])1)
- inchi-key:
- ayfxpgxazmfwnh-onegzznksa-m
- molecular-weight:
- 139.087
