Difference between revisions of "Acceptor"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17263 == * common-name: ** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)scc...")
(Created page with "Category:metabolite == Metabolite CPD-8974 == * common-name: ** dimethylthiophosphate * smiles: ** cop([o-])(=s)oc * inchi-key: ** wwjjvkaeqggyhj-uhfffaoysa-m * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17263 ==
+
== Metabolite CPD-8974 ==
 
* common-name:
 
* common-name:
** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
+
** dimethylthiophosphate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cop([o-])(=s)oc
 
* inchi-key:
 
* inchi-key:
** pcgphlmaazkqfq-fpxdaddusa-j
+
** wwjjvkaeqggyhj-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1065.958
+
** 141.101
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16021]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16020]]
+
* [[RXN-8743]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa}}
+
{{#set: common-name=dimethylthiophosphate}}
{{#set: inchi-key=inchikey=pcgphlmaazkqfq-fpxdaddusa-j}}
+
{{#set: inchi-key=inchikey=wwjjvkaeqggyhj-uhfffaoysa-m}}
{{#set: molecular-weight=1065.958}}
+
{{#set: molecular-weight=141.101}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-8974

  • common-name:
    • dimethylthiophosphate
  • smiles:
    • cop([o-])(=s)oc
  • inchi-key:
    • wwjjvkaeqggyhj-uhfffaoysa-m
  • molecular-weight:
    • 141.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality