Difference between revisions of "Acetoacetyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...") |
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-Me-Branched-234-Sat-FA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-methyl branched 2,3,4-saturated fatty acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-483]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-472]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty acid}} |
| − | |||
| − | |||
Revision as of 15:00, 5 January 2021
Contents
Metabolite 2-Me-Branched-234-Sat-FA
- common-name:
- a 2-methyl branched 2,3,4-saturated fatty acid
