Difference between revisions of "Acyl-Phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Acyl-Phosphates == * common-name: ** an acyl phosphate == Reaction(s) known to consume the compound == * ACYLPHOSPHATASE-RXN == React...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Acyl-Phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** an acyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACYLPHOSPHATASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an acyl phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Acyl-Phosphates
- common-name:
- an acyl phosphate
