Difference between revisions of "Acyl-Phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRULOSE == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co * inchi-key: ** uqphvqvxlprncx-gsvougtgsa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GALACTOSE-1P == |
* common-name: | * common-name: | ||
| − | ** d- | + | ** α-d-galactose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** c(o)c(o)c( | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hxxfsfrbohsimq-fprjbgldsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GALACTOKIN-RXN]] |
| − | * [[RXN | + | * [[GALACTURIDYLYLTRANS-RXN]] |
| + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GALACTOKIN-RXN]] |
| − | * [[RXN | + | * [[GALACTURIDYLYLTRANS-RXN]] |
| + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=d- | + | {{#set: common-name=α-d-galactose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite GALACTOSE-1P
- common-name:
- α-d-galactose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-fprjbgldsa-l
- molecular-weight:
- 258.121
