Difference between revisions of "Acylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-281 == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(sc(ccccc(n)=o)ccs)=o)c * inchi-key: ** xzukurpvwdtx...")
(Created page with "Category:metabolite == Metabolite Acylcholines == * common-name: ** an acylcholine == Reaction(s) known to consume the compound == * CHOLINESTERASE-RXN == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-281 ==
+
== Metabolite Acylcholines ==
 
* common-name:
 
* common-name:
** s-(2-methylpropanoyl)-dihydrolipoamide
+
** an acylcholine
* smiles:
 
** cc(c(sc(ccccc(n)=o)ccs)=o)c
 
* inchi-key:
 
** xzukurpvwdtxge-uhfffaoysa-n
 
* molecular-weight:
 
** 277.439
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
+
* [[CHOLINESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
+
{{#set: common-name=an acylcholine}}
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
 
{{#set: molecular-weight=277.439}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Acylcholines

  • common-name:
    • an acylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality