Difference between revisions of "Acylcholines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Dimetgua-26-MeGua27 == * common-name: ** an n2-dimethylguanine26/n2-methylguanine27 == Reaction(s) known to consume th...") |
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LINAMARIN == |
* common-name: | * common-name: | ||
− | ** | + | ** linamarin |
+ | * smiles: | ||
+ | ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) | ||
+ | * inchi-key: | ||
+ | ** qltchmyaejexbt-zebdfxrssa-n | ||
+ | * molecular-weight: | ||
+ | ** 247.247 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-5341]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=linamarin}} |
+ | {{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}} | ||
+ | {{#set: molecular-weight=247.247}} |
Revision as of 18:52, 14 January 2021
Contents
Metabolite LINAMARIN
- common-name:
- linamarin
- smiles:
- cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
- inchi-key:
- qltchmyaejexbt-zebdfxrssa-n
- molecular-weight:
- 247.247