Difference between revisions of "Acylcholines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * smiles: ** c(s([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** jxylqemxcaamol-uhfffao...") |
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LINAMARIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** linamarin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qltchmyaejexbt-zebdfxrssa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 247.247 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5341]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=linamarin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qltchmyaejexbt-zebdfxrssa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=247.247}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite LINAMARIN
- common-name:
- linamarin
- smiles:
- cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1)
- inchi-key:
- qltchmyaejexbt-zebdfxrssa-n
- molecular-weight:
- 247.247
