Difference between revisions of "Adenine-34-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...") |
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-o-sinapoyl-β-d-glucose |
* smiles: | * smiles: | ||
| − | ** cc(c(=o) | + | ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xrkbrpftfkkhef-dgdbgzaxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 386.355 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.3.1.91-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-o-sinapoyl-β-d-glucose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=386.355}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE
- common-name:
- 1-o-sinapoyl-β-d-glucose
- smiles:
- coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
- inchi-key:
- xrkbrpftfkkhef-dgdbgzaxsa-n
- molecular-weight:
- 386.355
