Difference between revisions of "Adenine-37-tRNA-Alas"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE == * common-name: ** 1-palmitoylglycerol 3-phosphate * smiles: ** cccccccccccccccc(=o)occ(o)cop(=o)([o-])...") |
(Created page with "Category:metabolite == Metabolite CPD-11411 == * common-name: ** tetraiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11411 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate ester glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzmjvzbexskssm-kfyubchvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 922.95 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10617]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate ester glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzmjvzbexskssm-kfyubchvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=922.95}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-11411
- common-name:
- tetraiodothyroacetate ester glucuronide
- smiles:
- c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
- inchi-key:
- xzmjvzbexskssm-kfyubchvsa-m
- molecular-weight:
- 922.95
