Difference between revisions of "Adenine57-Adenine58-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-]) * inchi-key: ** cgqcwmiaepehnq-...")
(Created page with "Category:metabolite == Metabolite Adenine57-Adenine58-tRNAs == * common-name: ** an adenine57/adenine58 in trna == Reaction(s) known to consume the compound == * RXN-124...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite VANILLYL_MANDELATE ==
+
== Metabolite Adenine57-Adenine58-tRNAs ==
 
* common-name:
 
* common-name:
** vanillyl mandelate
+
** an adenine57/adenine58 in trna
* smiles:
 
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
 
* inchi-key:
 
** cgqcwmiaepehnq-mrvpvssysa-m
 
* molecular-weight:
 
** 197.167
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12469]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10917]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=vanillyl mandelate}}
+
{{#set: common-name=an adenine57/adenine58 in trna}}
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
 
{{#set: molecular-weight=197.167}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Adenine57-Adenine58-tRNAs

  • common-name:
    • an adenine57/adenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality