Difference between revisions of "Adenine57-Adenine58-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17981 == * transcription-direction: ** positive * right-end-position: ** 72750 * left-end-position: ** 48843 * centisome-position: ** 19.278332...")
(Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-]) * inchi-key: ** cgqcwmiaepehnq-...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17981 ==
+
== Metabolite VANILLYL_MANDELATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** vanillyl mandelate
−
* right-end-position:
+
* smiles:
−
** 72750
+
** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
−
* left-end-position:
+
* inchi-key:
−
** 48843
+
** cgqcwmiaepehnq-mrvpvssysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 19.278332   
+
** 197.167
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10917]]
−
* [[R145-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=vanillyl mandelate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
−
* [[R147-RXN]]
+
{{#set: molecular-weight=197.167}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-4361]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=72750}}
 
−
{{#set: left-end-position=48843}}
 
−
{{#set: centisome-position=19.278332    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite VANILLYL_MANDELATE

  • common-name:
    • vanillyl mandelate
  • smiles:
    • coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
  • inchi-key:
    • cgqcwmiaepehnq-mrvpvssysa-m
  • molecular-weight:
    • 197.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Adenine57-Adenine58-tRNAs&oldid=46231"