Difference between revisions of "Adenine57-Adenine58-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-key: ** fuesbomyallfni-vkhmyheas...") |
(Created page with "Category:metabolite == Metabolite mRNAs-With-PolyA-Tails == * common-name: ** a mrna with poly(a) tail == Reaction(s) known to consume the compound == * 3.1.13.4-RXN =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite mRNAs-With-PolyA-Tails == |
* common-name: | * common-name: | ||
| − | ** | + | ** a mrna with poly(a) tail |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.13.4-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a mrna with poly(a) tail}} |
| − | |||
| − | |||
Revision as of 18:54, 14 January 2021
Contents
Metabolite mRNAs-With-PolyA-Tails
- common-name:
- a mrna with poly(a) tail
