Difference between revisions of "Adenine57-Adenine58-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-oxoacyl-CoAs == * common-name: ** a long-chain 3-oxoacyl-coa == Reaction(s) known to consume the compound == * 1.1.1.211-RXN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Long-Chain-oxoacyl-CoAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a long-chain 3-oxoacyl-coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.1.1.211-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.1.1.211-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a long-chain 3-oxoacyl-coa}} |
− | |||
− |
Revision as of 08:25, 15 March 2021
Contents
Metabolite Long-Chain-oxoacyl-CoAs
- common-name:
- a long-chain 3-oxoacyl-coa