Difference between revisions of "Alcohols"

Latest revision as of 11:18, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15016 ==
+== Metabolite Alcohols ==
 * common-name:
-** (4s)-4-hydroxy-2-oxoglutarate
+** an alcohol
-* smiles:
-** c(c(=o)c([o-])=o)c(c([o-])=o)o
-* inchi-key:
-** wxskvkpsmahcsg-reohclbhsa-l
-* molecular-weight:
-** 160.083
 == Reaction(s) known to consume the compound ==
-* [[RXN-13990]]
+* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13990]]
+* [[1.11.1.15-RXN]]
+* [[3.2.1.52-RXN]]
+* [[ACID-PHOSPHATASE-RXN]]
+* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
+* [[ALKAPHOSPHA-RXN]]
+* [[BETA-L-ARABINOSIDASE-RXN]]
+* [[CARBOXYLESTERASE-RXN]]
+* [[GLYCPDIESTER-RXN]]
+* [[RXN-12615]]
+* [[RXN0-5468]]
+* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}}
+{{#set: common-name=an alcohol}}
-{{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}}
-{{#set: molecular-weight=160.083}}