Difference between revisions of "Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...")
(Created page with "Category:metabolite == Metabolite Aldehydes == * common-name: ** an aldehyde == Reaction(s) known to consume the compound == * ALCOHOL-DEHYDROG-GENERIC-RXN * ALCOHOL...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMYUL-L-ASPARTATE ==
+
== Metabolite Aldehydes ==
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** an aldehyde
* smiles:
 
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
 
* inchi-key:
 
** hlkxyzvtanabhz-reohclbhsa-l
 
* molecular-weight:
 
** 174.113
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
* [[DIHYDROOROT-RXN]]
+
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALDHDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
* [[DIHYDROOROT-RXN]]
+
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 +
* [[RXN-9598]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-carbamoyl-l-aspartate}}
+
{{#set: common-name=an aldehyde}}
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
 
{{#set: molecular-weight=174.113}}
 

Latest revision as of 11:11, 18 March 2021