Difference between revisions of "Aldehydes"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18904 == * transcription-direction: ** positive * right-end-position: ** 10675 * left-end-position: ** 153 * centisome-position: ** 6.53656200e-2 =...") |
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CARBAMYUL-L-ASPARTATE == |
| − | * | + | * common-name: |
| − | ** | + | ** n-carbamoyl-l-aspartate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)([o-])cc(nc(n)=o)c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** hlkxyzvtanabhz-reohclbhsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 174.113 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ASPCARBTRANS-RXN]] |
| − | == Reaction(s) | + | * [[DIHYDROOROT-RXN]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ASPCARBTRANS-RXN]] |
| − | + | * [[DIHYDROOROT-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=n-carbamoyl-l-aspartate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}} |
| − | + | {{#set: molecular-weight=174.113}} | |
| − | {{#set: | ||
| − | |||
Revision as of 20:29, 18 December 2020
Contents
Metabolite CARBAMYUL-L-ASPARTATE
- common-name:
- n-carbamoyl-l-aspartate
- smiles:
- c(=o)([o-])cc(nc(n)=o)c([o-])=o
- inchi-key:
- hlkxyzvtanabhz-reohclbhsa-l
- molecular-weight:
- 174.113
