Difference between revisions of "Aldoses"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * inchi-key: ** fxnfhkrtjbstcs...") |
(Created page with "Category:metabolite == Metabolite Aldoses == * common-name: ** an aldose == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN == Reaction(s) known...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Aldoses == |
* common-name: | * common-name: | ||
| − | ** | + | ** an aldose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[ALDEHYDE-REDUCTASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ALDEHYDE-REDUCTASE-RXN]] | ||
| + | * [[RXN-9926]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an aldose}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Aldoses
- common-name:
- an aldose
