Difference between revisions of "Aldoses"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...")
(Created page with "Category:metabolite == Metabolite Aldoses == * common-name: ** an aldose == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN == Reaction(s) known...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBULOSE-5P ==
+
== Metabolite Aldoses ==
 
* common-name:
 
* common-name:
** d-ribulose 5-phosphate
+
** an aldose
* smiles:
 
** c(c(c(c(co)=o)o)o)op([o-])([o-])=o
 
* inchi-key:
 
** fnzlkvnuwiipsj-uhnvwzdzsa-l
 
* molecular-weight:
 
** 228.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
* [[PHOSPHORIBULOKINASE-RXN]]
 
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
* [[PHOSPHORIBULOKINASE-RXN]]
+
* [[RXN-9926]]
* [[RIB5PISOM-RXN]]
 
* [[RIBULP3EPIM-RXN]]
 
* [[RXN-3341]]
 
* [[RXN-9952]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribulose 5-phosphate}}
+
{{#set: common-name=an aldose}}
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Aldoses

  • common-name:
    • an aldose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality