Difference between revisions of "Aldoses"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03004 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DOPAMINE-BETA-MONOOXYGEN...") |
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite RIBULOSE-5P == |
| − | = | + | * common-name: |
| − | * | + | ** d-ribulose 5-phosphate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o |
| − | * | + | * inchi-key: |
| − | * | + | ** fnzlkvnuwiipsj-uhnvwzdzsa-l |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 228.095 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | * [[DIOHBUTANONEPSYN-RXN]] |
| − | {{#set: | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| − | {{#set: | + | * [[RIB5PISOM-RXN]] |
| + | * [[RIBULP3EPIM-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[6PGLUCONDEHYDROG-RXN]] | ||
| + | * [[PHOSPHORIBULOKINASE-RXN]] | ||
| + | * [[RIB5PISOM-RXN]] | ||
| + | * [[RIBULP3EPIM-RXN]] | ||
| + | * [[RXN-3341]] | ||
| + | * [[RXN-9952]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=d-ribulose 5-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite RIBULOSE-5P
- common-name:
- d-ribulose 5-phosphate
- smiles:
- c(c(c(c(co)=o)o)o)op([o-])([o-])=o
- inchi-key:
- fnzlkvnuwiipsj-uhnvwzdzsa-l
- molecular-weight:
- 228.095
