Difference between revisions of "Aliphatic-L-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17382 == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite Phospho-DNA-directed-RNA-polymerases == * common-name: ** phospho-[dna-directed rna-polymerase] == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17382 ==
+
== Metabolite Phospho-DNA-directed-RNA-polymerases ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-tetracosapentaenoyl-coa
+
** phospho-[dna-directed rna-polymerase]
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** drqaurckckdinz-kpyxopptsa-j
 
* molecular-weight:
 
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16130]]
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16129]]
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}}
+
{{#set: common-name=phospho-[dna-directed rna-polymerase]}}
{{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}}
 
{{#set: molecular-weight=1120.05}}
 

Revision as of 15:25, 5 January 2021

Metabolite Phospho-DNA-directed-RNA-polymerases

  • common-name:
    • phospho-[dna-directed rna-polymerase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "phospho-[dna-directed rna-polymerase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.