Difference between revisions of "Aliphatic-L-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13121 == * transcription-direction: ** negative * right-end-position: ** 204117 * left-end-position: ** 201567 * centisome-position: ** 58.31906...") |
(Created page with "Category:metabolite == Metabolite CPD-8079 == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-8079 == |
− | * | + | * common-name: |
− | ** | + | ** 1-18:1-2-16:3-monogalactosyldiacylglycerol |
− | * | + | * smiles: |
− | ** | + | ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o |
− | * | + | * inchi-key: |
− | ** | + | ** uledcqdcqahgfd-lukloydesa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 751.052 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-8303]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}} | |
− | + | {{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}} | |
− | + | {{#set: molecular-weight=751.052}} | |
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-8079
- common-name:
- 1-18:1-2-16:3-monogalactosyldiacylglycerol
- smiles:
- ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
- inchi-key:
- uledcqdcqahgfd-lukloydesa-n
- molecular-weight:
- 751.052