Difference between revisions of "Alkyl-Hydro-Peroxides"

Revision as of 13:12, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CYTIDINE ==
+== Metabolite MYO-INOSITOL ==
 * common-name:
-** cytidine
+** myo-inositol
 * smiles:
-** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
+** c1(c(c(c(c(c1o)o)o)o)o)o
 * inchi-key:
-** uhdgcwiwmrvcdj-xvfcmesisa-n
+** cdaismweouebre-gpivlxjgsa-n
 * molecular-weight:
-** 243.219
+** 180.157
 == Reaction(s) known to consume the compound ==
-* [[ATCY]]
+* [[2.4.1.123-RXN]]
-* [[ATDTD]]
+* [[2.4.1.67-RXN]]
-* [[ATDTDm]]
+* [[2.7.8.11-RXN]]
-* [[CYTIDEAM2-RXN]]
+* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
-* [[DATCY]]
+* [[MYO-INOSITOL-OXYGENASE-RXN]]
-* [[DCTCP]]
-* [[DGTCY]]
-* [[DTTGY]]
-* [[DTTPtm]]
-* [[DUTCP]]
-* [[GTCY]]
-* [[ITCY]]
-* [[RXN0-361]]
-* [[UTCY]]
 == Reaction(s) known to produce the compound ==
-* [[ATDTM]]
+* [[2.4.1.67-RXN]]
-* [[DTTGY]]
+* [[2.4.1.82-RXN]]
-* [[DTTPtm]]
+* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
-* [[DTTUP]]
+* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
-* [[RXN-14026]]
+* [[RXN-10949]]
+* [[RXN-10952]]
+* [[RXN-10953]]
+* [[RXN-10954]]
+* [[RXN-7253]]
+* [[RXN-8281]]
+* [[RXN0-5408]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cytidine}}
+{{#set: common-name=myo-inositol}}
-{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
+{{#set: inchi-key=inchikey=cdaismweouebre-gpivlxjgsa-n}}
-{{#set: molecular-weight=243.219}}
+{{#set: molecular-weight=180.157}}