Difference between revisions of "Alkyl-Hydro-Peroxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SALICYLATE-1-MONOOXYGENASE-RXN SALICYLATE-1-MONOOXYGENASE-RXN] == * direction: ** left-to-right * c...")
(Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SALICYLATE-1-MONOOXYGENASE-RXN SALICYLATE-1-MONOOXYGENASE-RXN] ==
+
== Metabolite CPD-19168 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** salicylate 1-monooxygenase
+
** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.13.1 ec-1.14.13.1]
+
** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-110]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CATECHOL]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
** kzlhpkriedlqgg-squpixldsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ21101]]
+
** 1015.898
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17781]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-6183]], salicylate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6183 PWY-6183]
+
* [[RXN-17780]]
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
== External links  ==
+
{{#set: molecular-weight=1015.898}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11005 11005]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00818 R00818]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P23262 P23262]
 
** [http://www.uniprot.org/uniprot/Q53552 Q53552]
 
** [http://www.uniprot.org/uniprot/Q59700 Q59700]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=salicylate 1-monooxygenase}}
 
{{#set: ec-number=ec-1.14.13.1}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-19168

  • common-name:
    • (s)-3-hydroxy-(7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kzlhpkriedlqgg-squpixldsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality