Difference between revisions of "Alkyl-enyl-acyl-gly-P-EtOH-amines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
(Created page with "Category:metabolite == Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines == * common-name: ** a plasmenylethanolamine == Reaction(s) known to consume the compound == * RXN-17...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a plasmenylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17735]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a plasmenylethanolamine}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Alkyl-enyl-acyl-gly-P-EtOH-amines
- common-name:
- a plasmenylethanolamine
