Difference between revisions of "Alkyl-enyl-acyl-gly-P-EtOH-amines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03311 == * transcription-direction: ** negative * right-end-position: ** 303625 * left-end-position: ** 285937 * centisome-position: ** 54.336166...")
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03311 ==
+
== Metabolite CPD1F-2 ==
* transcription-direction:
+
* common-name:
** negative
+
** (-)-methyl jasmonate
* right-end-position:
+
* smiles:
** 303625
+
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
* left-end-position:
+
* inchi-key:
** 285937
+
** gewdntwnsazudx-wqmvxfaesa-n
* centisome-position:
+
* molecular-weight:
** 54.336166   
+
** 224.299
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10767]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[1.1.3.37-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(-)-methyl jasmonate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
* [[L-GULONOLACTONE-OXIDASE-RXN]]
+
{{#set: molecular-weight=224.299}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-13689]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY3O-6]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY3DJ-35471]]
 
** '''3''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-6387]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7953]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6386]]
 
** '''2''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY0-1261]]
 
** '''3''' reactions found over '''12''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=303625}}
 
{{#set: left-end-position=285937}}
 
{{#set: centisome-position=54.336166    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=6}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD1F-2

  • common-name:
    • (-)-methyl jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(oc)=o)
  • inchi-key:
    • gewdntwnsazudx-wqmvxfaesa-n
  • molecular-weight:
    • 224.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality