Difference between revisions of "All-trans-Retinyl-Esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...")
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RETINOL-O-FA...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14602 ==
+
== Metabolite All-trans-Retinyl-Esters ==
 
* common-name:
 
* common-name:
** mycophenolic acid o-acyl-glucuronide
+
** an all-trans-retinyl ester
* smiles:
 
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 
* inchi-key:
 
** qbmstezxamabff-uearnrkisa-m
 
* molecular-weight:
 
** 495.459
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13605]]
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 +
* [[RXN-12575]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13607]]
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
+
{{#set: common-name=an all-trans-retinyl ester}}
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
 
{{#set: molecular-weight=495.459}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite All-trans-Retinyl-Esters

  • common-name:
    • an all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality