Difference between revisions of "All-trans-Retinyl-Esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...")
(Created page with "Category:metabolite == Metabolite apo-ACP == * common-name: ** an apo-[acyl-carrier protein] == Reaction(s) known to consume the compound == * HOLO-ACP-SYNTH-RXN == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14602 ==
+
== Metabolite apo-ACP ==
 
* common-name:
 
* common-name:
** mycophenolic acid o-acyl-glucuronide
+
** an apo-[acyl-carrier protein]
* smiles:
 
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 
* inchi-key:
 
** qbmstezxamabff-uearnrkisa-m
 
* molecular-weight:
 
** 495.459
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13605]]
+
* [[HOLO-ACP-SYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13607]]
+
* [[3.1.4.14-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
+
{{#set: common-name=an apo-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
 
{{#set: molecular-weight=495.459}}
 

Revision as of 15:31, 5 January 2021

Metabolite apo-ACP

  • common-name:
    • an apo-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.