Difference between revisions of "Alpha-Acetylgalactosaminides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17367 == * common-name: ** (3r)-hydroxy-adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite CPD-6262 == * common-name: ** a [cys-gly]-s-conjugate == Reaction(s) known to consume the compound == * RXN-6642 == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17367 ==
+
== Metabolite CPD-6262 ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-adrenoyl-coa
+
** a [cys-gly]-s-conjugate
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jhxlrlhtjymvbk-dhdhvehbsa-j
 
* molecular-weight:
 
** 1094.012
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16113]]
+
* [[RXN-6642]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16112]]
+
* [[RXN-6641]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-adrenoyl-coa}}
+
{{#set: common-name=a [cys-gly]-s-conjugate}}
{{#set: inchi-key=inchikey=jhxlrlhtjymvbk-dhdhvehbsa-j}}
 
{{#set: molecular-weight=1094.012}}
 

Revision as of 08:31, 15 March 2021

Metabolite CPD-6262

  • common-name:
    • a [cys-gly]-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [cys-gly]-s-conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.